C17H29F2NO — CID 82006053
N-[1-(1-adamantyl)-2-(2,2-difluoroethoxy)ethyl]propan-1-amine (PubChem CID 82006053) has the molecular formula C17H29F2NO and a molecular weight of 301.42 g/mol. Its IUPAC name is N-[1-(1-adamantyl)-2-(2,2-difluoroethoxy)ethyl]propan-1-amine.
| Compound Name | N-[1-(1-adamantyl)-2-(2,2-difluoroethoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 82006053 |
| Molecular Formula | C17H29F2NO |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | N-[1-(1-adamantyl)-2-(2,2-difluoroethoxy)ethyl]propan-1-amine |
| SMILES | CCCNC(COCC(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H29F2NO/c1-2-3-20-15(10-21-11-16(18)19)17-7-12-4-13(8-17)6-14(5-12)9-17/h12-16,20H,2-11H2,1H3 |
| InChIKey | PFWBRLHIXQMUSV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |