C10H10F2O3S — CID 82007289
(E)-3-[5-(2,2-difluoroethoxymethyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 82007289) has the molecular formula C10H10F2O3S and a molecular weight of 248.25 g/mol. Its IUPAC name is (E)-3-[5-(2,2-difluoroethoxymethyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(2,2-difluoroethoxymethyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82007289 |
| Molecular Formula | C10H10F2O3S |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | (E)-3-[5-(2,2-difluoroethoxymethyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(COCC(F)F)s1 |
| InChI | InChI=1S/C10H10F2O3S/c11-9(12)6-15-5-8-2-1-7(16-8)3-4-10(13)14/h1-4,9H,5-6H2,(H,13,14)/b4-3+ |
| InChIKey | ZAFCQGVTEZMEQG-ONEGZZNKSA-N |
| XLogP | 2.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|