C17H18N2O2 — CID 82018984
6-methyl-4-(3-methylpiperidin-1-yl)-2-oxochromene-3-carbonitrile (PubChem CID 82018984) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 6-methyl-4-(3-methylpiperidin-1-yl)-2-oxochromene-3-carbonitrile.
| Compound Name | 6-methyl-4-(3-methylpiperidin-1-yl)-2-oxochromene-3-carbonitrile |
|---|---|
| PubChem CID | 82018984 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 6-methyl-4-(3-methylpiperidin-1-yl)-2-oxochromene-3-carbonitrile |
| SMILES | Cc1ccc2oc(=O)c(C#N)c(N3CCCC(C)C3)c2c1 |
| InChI | InChI=1S/C17H18N2O2/c1-11-5-6-15-13(8-11)16(14(9-18)17(20)21-15)19-7-3-4-12(2)10-19/h5-6,8,12H,3-4,7,10H2,1-2H3 |
| InChIKey | KOKZUCPXONWVBM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|