C14H23N3 — CID 82021402
1-N,1-N-dimethyl-4-(3-methylpiperidin-1-yl)benzene-1,3-diamine (PubChem CID 82021402) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-4-(3-methylpiperidin-1-yl)benzene-1,3-diamine.
| Compound Name | 1-N,1-N-dimethyl-4-(3-methylpiperidin-1-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 82021402 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 1-N,1-N-dimethyl-4-(3-methylpiperidin-1-yl)benzene-1,3-diamine |
| SMILES | CC1CCCN(c2ccc(N(C)C)cc2N)C1 |
| InChI | InChI=1S/C14H23N3/c1-11-5-4-8-17(10-11)14-7-6-12(16(2)3)9-13(14)15/h6-7,9,11H,4-5,8,10,15H2,1-3H3 |
| InChIKey | ZVTXJUQRBZQDJH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|