C16H19NO5 — CID 82022039
2-(6-acetyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)butanoic acid (PubChem CID 82022039) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-(6-acetyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)butanoic acid.
| Compound Name | 2-(6-acetyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 82022039 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(6-acetyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)butanoic acid |
| SMILES | CCC(C(=O)O)N1C(=O)C(C)(C)Oc2ccc(C(C)=O)cc21 |
| InChI | InChI=1S/C16H19NO5/c1-5-11(14(19)20)17-12-8-10(9(2)18)6-7-13(12)22-16(3,4)15(17)21/h6-8,11H,5H2,1-4H3,(H,19,20) |
| InChIKey | UCEZAZGKTNEJMY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |