2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid

C14H17NO4 — CID 82025451

IUPAC2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid
SMILESCCC(C(=O)O)N1CCOc2ccc(C(C)=O)cc21
InChIInChI=1S/C14H17NO4/c1-3-11(14(17)18)15-6-7-19-13-5-4-10(9(2)16)8-12(13)15/h4-5,8,11H,3,6-7H2,1-2H3,(H,17,18)
InChIKeyHTRMDZIMZWTXND-UHFFFAOYSA-N
MW263.29 g/mol
LogP1.95
Rot. Bonds4

About 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid

2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid (PubChem CID 82025451) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid.

Molecular Properties

Compound Name2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid
PubChem CID82025451
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Name2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid
SMILESCCC(C(=O)O)N1CCOc2ccc(C(C)=O)cc21
InChIInChI=1S/C14H17NO4/c1-3-11(14(17)18)15-6-7-19-13-5-4-10(9(2)16)8-12(13)15/h4-5,8,11H,3,6-7H2,1-2H3,(H,17,18)
InChIKeyHTRMDZIMZWTXND-UHFFFAOYSA-N
XLogP1.95
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid?
The IUPAC name of 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid (CID 82025451) is 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid.
What is the SMILES notation for 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid?
The canonical SMILES for 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid is CCC(C(=O)O)N1CCOc2ccc(C(C)=O)cc21.
What is the InChIKey of 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid?
The InChIKey is HTRMDZIMZWTXND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-3-11(14(17)18)15-6-7-19-13-5-4-10(9(2)16)8-12(13)15/h4-5,8,11H,3,6-7H2,1-2H3,(H,17,18).
What are the key properties of 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid?
2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid has a molecular weight of 263.29 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-acetyl-2,3-dihydro-1,4-benzoxazin-4-yl)butanoic acid is sourced from PubChem (CID 82025451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).