C19H21N3O2S — CID 82022213
2-[(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]hexanoic acid (PubChem CID 82022213) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-[(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]hexanoic acid.
| Compound Name | 2-[(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 82022213 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]hexanoic acid |
| SMILES | CCCCC(Nc1ncnc2sc(C)c(-c3ccccc3)c12)C(=O)O |
| InChI | InChI=1S/C19H21N3O2S/c1-3-4-10-14(19(23)24)22-17-16-15(13-8-6-5-7-9-13)12(2)25-18(16)21-11-20-17/h5-9,11,14H,3-4,10H2,1-2H3,(H,23,24)(H,20,21,22) |
| InChIKey | VDONARQFUABECL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |