C12H16N2O2 — CID 82024478
3-pyridin-2-yl-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 82024478) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-pyridin-2-yl-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 3-pyridin-2-yl-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 82024478 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-pyridin-2-yl-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | c1ccc(C2COC3(CCNCC3)O2)nc1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-6-14-10(3-1)11-9-15-12(16-11)4-7-13-8-5-12/h1-3,6,11,13H,4-5,7-9H2 |
| InChIKey | RDCJCRZDNFRLHH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |