C14H16N2S — CID 820293
(2E)-2-(2,2-dimethyl-3,5-dihydro-1,5-benzothiazepin-4-ylidene)propanenitrile (PubChem CID 820293) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is (2E)-2-(2,2-dimethyl-3,5-dihydro-1,5-benzothiazepin-4-ylidene)propanenitrile.
| Compound Name | (2E)-2-(2,2-dimethyl-3,5-dihydro-1,5-benzothiazepin-4-ylidene)propanenitrile |
|---|---|
| PubChem CID | 820293 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2E)-2-(2,2-dimethyl-3,5-dihydro-1,5-benzothiazepin-4-ylidene)propanenitrile |
| SMILES | C/C(C#N)=C1/CC(C)(C)Sc2ccccc2N1 |
| InChI | InChI=1S/C14H16N2S/c1-10(9-15)12-8-14(2,3)17-13-7-5-4-6-11(13)16-12/h4-7,16H,8H2,1-3H3/b12-10+ |
| InChIKey | GQZINYLCRBDSQA-ZRDIBKRKSA-N |
| XLogP | 4.17 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|