C20H21ClN2O — CID 82029806
3-(1-chloroethyl)-5-methyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridine (PubChem CID 82029806) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is 3-(1-chloroethyl)-5-methyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 3-(1-chloroethyl)-5-methyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 82029806 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-(1-chloroethyl)-5-methyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridine |
| SMILES | C=C(C)COc1ccc(-c2nc3cccc(C)n3c2C(C)Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O/c1-13(2)12-24-17-10-8-16(9-11-17)19-20(15(4)21)23-14(3)6-5-7-18(23)22-19/h5-11,15H,1,12H2,2-4H3 |
| InChIKey | OMLOBGXNRIMPLC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|