C16H24N2O4S — CID 82033455
2-[[2-(2-ethylbutanoylamino)-5-methylthiophene-3-carbonyl]amino]butanoic acid (PubChem CID 82033455) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-[[2-(2-ethylbutanoylamino)-5-methylthiophene-3-carbonyl]amino]butanoic acid.
| Compound Name | 2-[[2-(2-ethylbutanoylamino)-5-methylthiophene-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 82033455 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-[[2-(2-ethylbutanoylamino)-5-methylthiophene-3-carbonyl]amino]butanoic acid |
| SMILES | CCC(CC)C(=O)Nc1sc(C)cc1C(=O)NC(CC)C(=O)O |
| InChI | InChI=1S/C16H24N2O4S/c1-5-10(6-2)13(19)18-15-11(8-9(4)23-15)14(20)17-12(7-3)16(21)22/h8,10,12H,5-7H2,1-4H3,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | TXACADLBKJECKQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |