C14H18N2O3S — CID 82036295
ethyl 6-tert-butyl-5-formyl-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate (PubChem CID 82036295) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is ethyl 6-tert-butyl-5-formyl-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate.
| Compound Name | ethyl 6-tert-butyl-5-formyl-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate |
|---|---|
| PubChem CID | 82036295 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | ethyl 6-tert-butyl-5-formyl-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(C(C)(C)C)c(C=O)n2c1C |
| InChI | InChI=1S/C14H18N2O3S/c1-6-19-12(18)10-8(2)16-9(7-17)11(14(3,4)5)15-13(16)20-10/h7H,6H2,1-5H3 |
| InChIKey | DIVODHHIQYGMTP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|