C14H13Cl2NO — CID 82039672
[3-(3,5-dichloro-2-methoxyphenyl)phenyl]methanamine (PubChem CID 82039672) has the molecular formula C14H13Cl2NO and a molecular weight of 282.17 g/mol. Its IUPAC name is [3-(3,5-dichloro-2-methoxyphenyl)phenyl]methanamine.
| Compound Name | [3-(3,5-dichloro-2-methoxyphenyl)phenyl]methanamine |
|---|---|
| PubChem CID | 82039672 |
| Molecular Formula | C14H13Cl2NO |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | [3-(3,5-dichloro-2-methoxyphenyl)phenyl]methanamine |
| SMILES | COc1c(Cl)cc(Cl)cc1-c1cccc(CN)c1 |
| InChI | InChI=1S/C14H13Cl2NO/c1-18-14-12(6-11(15)7-13(14)16)10-4-2-3-9(5-10)8-17/h2-7H,8,17H2,1H3 |
| InChIKey | SKCPPRFUKQKYMT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |