2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid

C13H17NO3S — CID 82042810

IUPAC2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid
SMILESCc1cc(C)cc(SCCC(=O)NCC(=O)O)c1
InChIInChI=1S/C13H17NO3S/c1-9-5-10(2)7-11(6-9)18-4-3-12(15)14-8-13(16)17/h5-7H,3-4,8H2,1-2H3,(H,14,15)(H,16,17)
InChIKeyOCDWPRUMGHATEF-UHFFFAOYSA-N
MW267.35 g/mol
LogP1.99
Rot. Bonds6

About 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid

2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid (PubChem CID 82042810) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid.

Molecular Properties

Compound Name2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid
PubChem CID82042810
Molecular FormulaC13H17NO3S
Molecular Weight267.35 g/mol
Exact Mass267.09
IUPAC Name2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid
SMILESCc1cc(C)cc(SCCC(=O)NCC(=O)O)c1
InChIInChI=1S/C13H17NO3S/c1-9-5-10(2)7-11(6-9)18-4-3-12(15)14-8-13(16)17/h5-7H,3-4,8H2,1-2H3,(H,14,15)(H,16,17)
InChIKeyOCDWPRUMGHATEF-UHFFFAOYSA-N
XLogP1.99
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.35
LogP ≤ 51.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid?
The IUPAC name of 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid (CID 82042810) is 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid.
What is the SMILES notation for 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid?
The canonical SMILES for 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid is Cc1cc(C)cc(SCCC(=O)NCC(=O)O)c1.
What is the InChIKey of 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid?
The InChIKey is OCDWPRUMGHATEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c1-9-5-10(2)7-11(6-9)18-4-3-12(15)14-8-13(16)17/h5-7H,3-4,8H2,1-2H3,(H,14,15)(H,16,17).
What are the key properties of 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid?
2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid has a molecular weight of 267.35 g/mol, XLogP of 1.99, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,5-dimethylphenyl)sulfanylpropanoylamino]acetic acid is sourced from PubChem (CID 82042810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).