C11H15NO3S — CID 82044488
N,2-dimethyl-5-propanoylbenzenesulfonamide (PubChem CID 82044488) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is N,2-dimethyl-5-propanoylbenzenesulfonamide.
| Compound Name | N,2-dimethyl-5-propanoylbenzenesulfonamide |
|---|---|
| PubChem CID | 82044488 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N,2-dimethyl-5-propanoylbenzenesulfonamide |
| SMILES | CCC(=O)c1ccc(C)c(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C11H15NO3S/c1-4-10(13)9-6-5-8(2)11(7-9)16(14,15)12-3/h5-7,12H,4H2,1-3H3 |
| InChIKey | OWONSEWNTGXWPY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |