C18H18O4 — CID 82047678
4-(5-ethoxy-3,4-dihydro-2H-chromen-2-yl)benzoic acid (PubChem CID 82047678) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-(5-ethoxy-3,4-dihydro-2H-chromen-2-yl)benzoic acid.
| Compound Name | 4-(5-ethoxy-3,4-dihydro-2H-chromen-2-yl)benzoic acid |
|---|---|
| PubChem CID | 82047678 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-(5-ethoxy-3,4-dihydro-2H-chromen-2-yl)benzoic acid |
| SMILES | CCOc1cccc2c1CCC(c1ccc(C(=O)O)cc1)O2 |
| InChI | InChI=1S/C18H18O4/c1-2-21-16-4-3-5-17-14(16)10-11-15(22-17)12-6-8-13(9-7-12)18(19)20/h3-9,15H,2,10-11H2,1H3,(H,19,20) |
| InChIKey | VIOLSPDVCOJSFJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |