C11H11ClN2O2 — CID 82049211
[3-(3-chloro-4-methoxyphenyl)-1H-pyrazol-5-yl]methanol (PubChem CID 82049211) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is [3-(3-chloro-4-methoxyphenyl)-1H-pyrazol-5-yl]methanol.
| Compound Name | [3-(3-chloro-4-methoxyphenyl)-1H-pyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 82049211 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | [3-(3-chloro-4-methoxyphenyl)-1H-pyrazol-5-yl]methanol |
| SMILES | COc1ccc(-c2cc(CO)[nH]n2)cc1Cl |
| InChI | InChI=1S/C11H11ClN2O2/c1-16-11-3-2-7(4-9(11)12)10-5-8(6-15)13-14-10/h2-5,15H,6H2,1H3,(H,13,14) |
| InChIKey | VWLATYSTAJKMSA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |