C13H15ClO3S — CID 82050861
1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-2-propylsulfanylethanone (PubChem CID 82050861) has the molecular formula C13H15ClO3S and a molecular weight of 286.78 g/mol. Its IUPAC name is 1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-2-propylsulfanylethanone.
| Compound Name | 1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-2-propylsulfanylethanone |
|---|---|
| PubChem CID | 82050861 |
| Molecular Formula | C13H15ClO3S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-2-propylsulfanylethanone |
| SMILES | CCCSCC(=O)c1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C13H15ClO3S/c1-2-5-18-8-11(15)9-6-12-13(7-10(9)14)17-4-3-16-12/h6-7H,2-5,8H2,1H3 |
| InChIKey | BAABOVDKGHHWJI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|