C17H20N4O — CID 82056443
4-[8-(3-methylbutoxy)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline (PubChem CID 82056443) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-[8-(3-methylbutoxy)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline.
| Compound Name | 4-[8-(3-methylbutoxy)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline |
|---|---|
| PubChem CID | 82056443 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 4-[8-(3-methylbutoxy)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline |
| SMILES | CC(C)CCOc1cccn2c(-c3ccc(N)cc3)nnc12 |
| InChI | InChI=1S/C17H20N4O/c1-12(2)9-11-22-15-4-3-10-21-16(19-20-17(15)21)13-5-7-14(18)8-6-13/h3-8,10,12H,9,11,18H2,1-2H3 |
| InChIKey | KABMXBUEYDJGKU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|