C14H22N2O2S — CID 82151747
2-methyl-3-[3-(3-methylbutoxy)-2-oxo-1-pyridinyl]propanethioamide (PubChem CID 82151747) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-methyl-3-[3-(3-methylbutoxy)-2-oxo-1-pyridinyl]propanethioamide.
| Compound Name | 2-methyl-3-[3-(3-methylbutoxy)-2-oxo-1-pyridinyl]propanethioamide |
|---|---|
| PubChem CID | 82151747 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-methyl-3-[3-(3-methylbutoxy)-2-oxo-1-pyridinyl]propanethioamide |
| SMILES | CC(C)CCOc1cccn(CC(C)C(N)=S)c1=O |
| InChI | InChI=1S/C14H22N2O2S/c1-10(2)6-8-18-12-5-4-7-16(14(12)17)9-11(3)13(15)19/h4-5,7,10-11H,6,8-9H2,1-3H3,(H2,15,19) |
| InChIKey | BZSRRFMFSUUQFY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|