C16H25N3O2S — CID 82151752
2-methyl-3-[2-oxo-3-(2-piperidin-1-ylethoxy)-1-pyridinyl]propanethioamide (PubChem CID 82151752) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-methyl-3-[2-oxo-3-(2-piperidin-1-ylethoxy)-1-pyridinyl]propanethioamide.
| Compound Name | 2-methyl-3-[2-oxo-3-(2-piperidin-1-ylethoxy)-1-pyridinyl]propanethioamide |
|---|---|
| PubChem CID | 82151752 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-methyl-3-[2-oxo-3-(2-piperidin-1-ylethoxy)-1-pyridinyl]propanethioamide |
| SMILES | CC(Cn1cccc(OCCN2CCCCC2)c1=O)C(N)=S |
| InChI | InChI=1S/C16H25N3O2S/c1-13(15(17)22)12-19-9-5-6-14(16(19)20)21-11-10-18-7-3-2-4-8-18/h5-6,9,13H,2-4,7-8,10-12H2,1H3,(H2,17,22) |
| InChIKey | SDTKTRFSFAIGBW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|