C15H21N3O3S — CID 82151242
2-[2-oxo-3-(3-oxo-3-piperidin-1-ylpropoxy)-1-pyridinyl]ethanethioamide (PubChem CID 82151242) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[2-oxo-3-(3-oxo-3-piperidin-1-ylpropoxy)-1-pyridinyl]ethanethioamide.
| Compound Name | 2-[2-oxo-3-(3-oxo-3-piperidin-1-ylpropoxy)-1-pyridinyl]ethanethioamide |
|---|---|
| PubChem CID | 82151242 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[2-oxo-3-(3-oxo-3-piperidin-1-ylpropoxy)-1-pyridinyl]ethanethioamide |
| SMILES | NC(=S)Cn1cccc(OCCC(=O)N2CCCCC2)c1=O |
| InChI | InChI=1S/C15H21N3O3S/c16-13(22)11-18-9-4-5-12(15(18)20)21-10-6-14(19)17-7-2-1-3-8-17/h4-5,9H,1-3,6-8,10-11H2,(H2,16,22) |
| InChIKey | RTGHEDSWJUTELN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|