C14H12BrN3 — CID 82059906
4-(6-bromo-8-methylimidazo[1,2-a]pyridin-2-yl)aniline (PubChem CID 82059906) has the molecular formula C14H12BrN3 and a molecular weight of 302.18 g/mol. Its IUPAC name is 4-(6-bromo-8-methylimidazo[1,2-a]pyridin-2-yl)aniline.
| Compound Name | 4-(6-bromo-8-methylimidazo[1,2-a]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 82059906 |
| Molecular Formula | C14H12BrN3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 4-(6-bromo-8-methylimidazo[1,2-a]pyridin-2-yl)aniline |
| SMILES | Cc1cc(Br)cn2cc(-c3ccc(N)cc3)nc12 |
| InChI | InChI=1S/C14H12BrN3/c1-9-6-11(15)7-18-8-13(17-14(9)18)10-2-4-12(16)5-3-10/h2-8H,16H2,1H3 |
| InChIKey | ALJCMYJBQKCMCR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|