C12H10N2OS — CID 82061842
(3-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methanol (PubChem CID 82061842) has the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. Its IUPAC name is (3-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methanol.
| Compound Name | (3-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 82061842 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (3-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methanol |
| SMILES | OCc1cnc2scc(-c3ccccc3)n12 |
| InChI | InChI=1S/C12H10N2OS/c15-7-10-6-13-12-14(10)11(8-16-12)9-4-2-1-3-5-9/h1-6,8,15H,7H2 |
| InChIKey | YZSWZGPQIDPWOO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |