About 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid
3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid (PubChem CID 82062120) has the molecular formula C11H7N3O2S
and a molecular weight of 245.26 g/mol. Its IUPAC name is 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid.
Analyze 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The IUPAC name of 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid (CID 82062120) is 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid.
What is the SMILES notation for 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The canonical SMILES for 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid is O=C(O)c1cnc2scc(-c3cccnc3)n12.
What is the InChIKey of 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The InChIKey is JJHFWARFQJDTJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O2S/c15-10(16)8-5-13-11-14(8)9(6-17-11)7-2-1-3-12-4-7/h1-6H,(H,15,16).
What are the key properties of 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid has a molecular weight of 245.26 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid is sourced from PubChem (CID 82062120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).