C14H17N3O3 — CID 82062962
6-(1,4-diazepane-1-carbonyl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 82062962) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-(1,4-diazepane-1-carbonyl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(1,4-diazepane-1-carbonyl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82062962 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 6-(1,4-diazepane-1-carbonyl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(=O)N3CCCNCC3)ccc21 |
| InChI | InChI=1S/C14H17N3O3/c1-16-11-4-3-10(9-12(11)20-14(16)19)13(18)17-7-2-5-15-6-8-17/h3-4,9,15H,2,5-8H2,1H3 |
| InChIKey | ZVHVEMWWYDZNOU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |