C16H14N2O2S — CID 82065133
2-[4-methyl-2-(naphthalen-1-ylamino)-1,3-thiazol-5-yl]acetic acid (PubChem CID 82065133) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-[4-methyl-2-(naphthalen-1-ylamino)-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[4-methyl-2-(naphthalen-1-ylamino)-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 82065133 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[4-methyl-2-(naphthalen-1-ylamino)-1,3-thiazol-5-yl]acetic acid |
| SMILES | Cc1nc(Nc2cccc3ccccc23)sc1CC(=O)O |
| InChI | InChI=1S/C16H14N2O2S/c1-10-14(9-15(19)20)21-16(17-10)18-13-8-4-6-11-5-2-3-7-12(11)13/h2-8H,9H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | WYMBBFMMULGQEZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |