C12H10F2N2O2S — CID 82065147
2-[2-(2,6-difluoroanilino)-4-methyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 82065147) has the molecular formula C12H10F2N2O2S and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-[2-(2,6-difluoroanilino)-4-methyl-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-(2,6-difluoroanilino)-4-methyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 82065147 |
| Molecular Formula | C12H10F2N2O2S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-[2-(2,6-difluoroanilino)-4-methyl-1,3-thiazol-5-yl]acetic acid |
| SMILES | Cc1nc(Nc2c(F)cccc2F)sc1CC(=O)O |
| InChI | InChI=1S/C12H10F2N2O2S/c1-6-9(5-10(17)18)19-12(15-6)16-11-7(13)3-2-4-8(11)14/h2-4H,5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | ASZWVQDHCKEZPW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |