C17H17ClN4S — CID 82065647
2-chloro-6-methyl-5-phenyl-4-piperazin-1-ylthieno[2,3-d]pyrimidine (PubChem CID 82065647) has the molecular formula C17H17ClN4S and a molecular weight of 344.87 g/mol. Its IUPAC name is 2-chloro-6-methyl-5-phenyl-4-piperazin-1-ylthieno[2,3-d]pyrimidine.
| Compound Name | 2-chloro-6-methyl-5-phenyl-4-piperazin-1-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 82065647 |
| Molecular Formula | C17H17ClN4S |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-chloro-6-methyl-5-phenyl-4-piperazin-1-ylthieno[2,3-d]pyrimidine |
| SMILES | Cc1sc2nc(Cl)nc(N3CCNCC3)c2c1-c1ccccc1 |
| InChI | InChI=1S/C17H17ClN4S/c1-11-13(12-5-3-2-4-6-12)14-15(22-9-7-19-8-10-22)20-17(18)21-16(14)23-11/h2-6,19H,7-10H2,1H3 |
| InChIKey | HJDWPRHLTCBQNA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |