C15H21ClN4S — CID 82066525
N-(10-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 82066525) has the molecular formula C15H21ClN4S and a molecular weight of 324.88 g/mol. Its IUPAC name is N-(10-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(10-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 82066525 |
| Molecular Formula | C15H21ClN4S |
| Molecular Weight | 324.88 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-(10-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1nc(Cl)nc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C15H21ClN4S/c1-3-20(4-2)9-8-17-13-12-10-6-5-7-11(10)21-14(12)19-15(16)18-13/h3-9H2,1-2H3,(H,17,18,19) |
| InChIKey | BXHOFPAIHDKRQL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.88 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |