C14H23ClN4 — CID 82460678
N-(2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 82460678) has the molecular formula C14H23ClN4 and a molecular weight of 282.82 g/mol. Its IUPAC name is N-(2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82460678 |
| Molecular Formula | C14H23ClN4 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-(2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(Cl)nc2c1CCC2 |
| InChI | InChI=1S/C14H23ClN4/c1-3-19(4-2)10-6-9-16-13-11-7-5-8-12(11)17-14(15)18-13/h3-10H2,1-2H3,(H,16,17,18) |
| InChIKey | OBCSUDBPJFGCHN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|