C14H15N3S — CID 82068410
3-(4-propan-2-ylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 82068410) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-(4-propan-2-ylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine.
| Compound Name | 3-(4-propan-2-ylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 82068410 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-(4-propan-2-ylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | CC(C)c1ccc(-c2csc3ncc(N)n23)cc1 |
| InChI | InChI=1S/C14H15N3S/c1-9(2)10-3-5-11(6-4-10)12-8-18-14-16-7-13(15)17(12)14/h3-9H,15H2,1-2H3 |
| InChIKey | NIPMXQBQRBWLEL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |