C12H17ClN2O2 — CID 82071511
3-(3-amino-4-chlorophenyl)-N-(2-hydroxyethyl)-N-methylpropanamide (PubChem CID 82071511) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is 3-(3-amino-4-chlorophenyl)-N-(2-hydroxyethyl)-N-methylpropanamide.
| Compound Name | 3-(3-amino-4-chlorophenyl)-N-(2-hydroxyethyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 82071511 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3-(3-amino-4-chlorophenyl)-N-(2-hydroxyethyl)-N-methylpropanamide |
| SMILES | CN(CCO)C(=O)CCc1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C12H17ClN2O2/c1-15(6-7-16)12(17)5-3-9-2-4-10(13)11(14)8-9/h2,4,8,16H,3,5-7,14H2,1H3 |
| InChIKey | QECYUSRRRFGRMJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|