C9H11ClN2O — CID 83796770
3-(3-amino-4-chlorophenyl)propanamide (PubChem CID 83796770) has the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. Its IUPAC name is 3-(3-amino-4-chlorophenyl)propanamide.
| Compound Name | 3-(3-amino-4-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 83796770 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 3-(3-amino-4-chlorophenyl)propanamide |
| SMILES | NC(=O)CCc1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C9H11ClN2O/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5H,2,4,11H2,(H2,12,13) |
| InChIKey | HVYMSKRGFTVTTI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|