C21H29N3 — CID 82071739
5-[3-(N-methylanilino)propyl]-2-piperidin-1-ylaniline (PubChem CID 82071739) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 5-[3-(N-methylanilino)propyl]-2-piperidin-1-ylaniline.
| Compound Name | 5-[3-(N-methylanilino)propyl]-2-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 82071739 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | 5-[3-(N-methylanilino)propyl]-2-piperidin-1-ylaniline |
| SMILES | CN(CCCc1ccc(N2CCCCC2)c(N)c1)c1ccccc1 |
| InChI | InChI=1S/C21H29N3/c1-23(19-10-4-2-5-11-19)14-8-9-18-12-13-21(20(22)17-18)24-15-6-3-7-16-24/h2,4-5,10-13,17H,3,6-9,14-16,22H2,1H3 |
| InChIKey | HANXCPOJENTDDK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|