About 2-(2,3,5,6-tetramethylphenyl)oxirane
2-(2,3,5,6-tetramethylphenyl)oxirane (PubChem CID 82074918) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-(2,3,5,6-tetramethylphenyl)oxirane.
Molecular Properties
| Compound Name | 2-(2,3,5,6-tetramethylphenyl)oxirane |
| PubChem CID | 82074918 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-(2,3,5,6-tetramethylphenyl)oxirane |
| SMILES | Cc1cc(C)c(C)c(C2CO2)c1C |
| InChI | InChI=1S/C12H16O/c1-7-5-8(2)10(4)12(9(7)3)11-6-13-11/h5,11H,6H2,1-4H3 |
| InChIKey | HYUQEXBCKYYHIY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3,5,6-tetramethylphenyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3,5,6-tetramethylphenyl)oxirane?
The IUPAC name of 2-(2,3,5,6-tetramethylphenyl)oxirane (CID 82074918) is 2-(2,3,5,6-tetramethylphenyl)oxirane.
What is the SMILES notation for 2-(2,3,5,6-tetramethylphenyl)oxirane?
The canonical SMILES for 2-(2,3,5,6-tetramethylphenyl)oxirane is Cc1cc(C)c(C)c(C2CO2)c1C.
What is the InChIKey of 2-(2,3,5,6-tetramethylphenyl)oxirane?
The InChIKey is HYUQEXBCKYYHIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-7-5-8(2)10(4)12(9(7)3)11-6-13-11/h5,11H,6H2,1-4H3.
What are the key properties of 2-(2,3,5,6-tetramethylphenyl)oxirane?
2-(2,3,5,6-tetramethylphenyl)oxirane has a molecular weight of 176.26 g/mol, XLogP of 2.99, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,5,6-tetramethylphenyl)oxirane is sourced from PubChem (CID 82074918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).