C12H16O — CID 82074918
2-(2,3,5,6-tetramethylphenyl)oxirane (PubChem CID 82074918) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-(2,3,5,6-tetramethylphenyl)oxirane.
| Compound Name | 2-(2,3,5,6-tetramethylphenyl)oxirane |
|---|---|
| PubChem CID | 82074918 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-(2,3,5,6-tetramethylphenyl)oxirane |
| SMILES | Cc1cc(C)c(C)c(C2CO2)c1C |
| InChI | InChI=1S/C12H16O/c1-7-5-8(2)10(4)12(9(7)3)11-6-13-11/h5,11H,6H2,1-4H3 |
| InChIKey | HYUQEXBCKYYHIY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|