C12H14F2O2 — CID 82081319
4-(3,4-difluorophenoxy)-4-methylpentan-2-one (PubChem CID 82081319) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 4-(3,4-difluorophenoxy)-4-methylpentan-2-one.
| Compound Name | 4-(3,4-difluorophenoxy)-4-methylpentan-2-one |
|---|---|
| PubChem CID | 82081319 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-(3,4-difluorophenoxy)-4-methylpentan-2-one |
| SMILES | CC(=O)CC(C)(C)Oc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2O2/c1-8(15)7-12(2,3)16-9-4-5-10(13)11(14)6-9/h4-6H,7H2,1-3H3 |
| InChIKey | UVYULBFIDWFSKU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |