C16H25NO — CID 82086631
3-(2,4-dimethylphenyl)-N,4,4-trimethylpentanamide (PubChem CID 82086631) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N,4,4-trimethylpentanamide.
| Compound Name | 3-(2,4-dimethylphenyl)-N,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 82086631 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N,4,4-trimethylpentanamide |
| SMILES | CNC(=O)CC(c1ccc(C)cc1C)C(C)(C)C |
| InChI | InChI=1S/C16H25NO/c1-11-7-8-13(12(2)9-11)14(16(3,4)5)10-15(18)17-6/h7-9,14H,10H2,1-6H3,(H,17,18) |
| InChIKey | WBHHWZVIDZRECN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |