C12H19N3O — CID 116849645
3-amino-3-(2,4-dimethylphenyl)-N'-methylpropanehydrazide (PubChem CID 116849645) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-amino-3-(2,4-dimethylphenyl)-N'-methylpropanehydrazide.
| Compound Name | 3-amino-3-(2,4-dimethylphenyl)-N'-methylpropanehydrazide |
|---|---|
| PubChem CID | 116849645 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-amino-3-(2,4-dimethylphenyl)-N'-methylpropanehydrazide |
| SMILES | CNNC(=O)CC(N)c1ccc(C)cc1C |
| InChI | InChI=1S/C12H19N3O/c1-8-4-5-10(9(2)6-8)11(13)7-12(16)15-14-3/h4-6,11,14H,7,13H2,1-3H3,(H,15,16) |
| InChIKey | VEXBFCDVWRMHJA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|