(E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid

C15H20O3 — CID 82086838

IUPAC(E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid
SMILESCCOc1ccc(/C(=C/C(=O)O)C(C)(C)C)cc1
InChIInChI=1S/C15H20O3/c1-5-18-12-8-6-11(7-9-12)13(10-14(16)17)15(2,3)4/h6-10H,5H2,1-4H3,(H,16,17)/b13-10-
InChIKeyIQQPRZHTBKAUKI-RAXLEYEMSA-N
MW248.32 g/mol
LogP3.60
Rot. Bonds4

About (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid

(E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid (PubChem CID 82086838) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid
PubChem CID82086838
Molecular FormulaC15H20O3
Molecular Weight248.32 g/mol
Exact Mass248.14
IUPAC Name(E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid
SMILESCCOc1ccc(/C(=C/C(=O)O)C(C)(C)C)cc1
InChIInChI=1S/C15H20O3/c1-5-18-12-8-6-11(7-9-12)13(10-14(16)17)15(2,3)4/h6-10H,5H2,1-4H3,(H,16,17)/b13-10-
InChIKeyIQQPRZHTBKAUKI-RAXLEYEMSA-N
XLogP3.60
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.32
LogP ≤ 53.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid?
The IUPAC name of (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid (CID 82086838) is (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid.
What is the SMILES notation for (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid?
The canonical SMILES for (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid is CCOc1ccc(/C(=C/C(=O)O)C(C)(C)C)cc1.
What is the InChIKey of (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid?
The InChIKey is IQQPRZHTBKAUKI-RAXLEYEMSA-N. The full InChI is InChI=1S/C15H20O3/c1-5-18-12-8-6-11(7-9-12)13(10-14(16)17)15(2,3)4/h6-10H,5H2,1-4H3,(H,16,17)/b13-10-.
What are the key properties of (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid?
(E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid has a molecular weight of 248.32 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4-ethoxyphenyl)-4,4-dimethylpent-2-enoic acid is sourced from PubChem (CID 82086838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).