C10H8Cl2N2O2 — CID 82089694
3-[(3,4-dichlorophenoxy)methyl]-1,2-oxazol-5-amine (PubChem CID 82089694) has the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenoxy)methyl]-1,2-oxazol-5-amine.
| Compound Name | 3-[(3,4-dichlorophenoxy)methyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 82089694 |
| Molecular Formula | C10H8Cl2N2O2 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 3-[(3,4-dichlorophenoxy)methyl]-1,2-oxazol-5-amine |
| SMILES | Nc1cc(COc2ccc(Cl)c(Cl)c2)no1 |
| InChI | InChI=1S/C10H8Cl2N2O2/c11-8-2-1-7(4-9(8)12)15-5-6-3-10(13)16-14-6/h1-4H,5,13H2 |
| InChIKey | DKXMXHYRUUPVLI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |