C15H14FNO2 — CID 82089784
2-cyclopropyl-5-(4-fluoro-3-methylphenyl)-1H-pyrrole-3-carboxylic acid (PubChem CID 82089784) has the molecular formula C15H14FNO2 and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-cyclopropyl-5-(4-fluoro-3-methylphenyl)-1H-pyrrole-3-carboxylic acid.
| Compound Name | 2-cyclopropyl-5-(4-fluoro-3-methylphenyl)-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 82089784 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-cyclopropyl-5-(4-fluoro-3-methylphenyl)-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1cc(-c2cc(C(=O)O)c(C3CC3)[nH]2)ccc1F |
| InChI | InChI=1S/C15H14FNO2/c1-8-6-10(4-5-12(8)16)13-7-11(15(18)19)14(17-13)9-2-3-9/h4-7,9,17H,2-3H2,1H3,(H,18,19) |
| InChIKey | AMRZCICKTALUEZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |