C12H6Cl2N2O — CID 82091639
4-(2,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 82091639) has the molecular formula C12H6Cl2N2O and a molecular weight of 265.10 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(2,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82091639 |
| Molecular Formula | C12H6Cl2N2O |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 4-(2,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cc(Cl)ccc2Cl)cc[nH]c1=O |
| InChI | InChI=1S/C12H6Cl2N2O/c13-7-1-2-11(14)9(5-7)8-3-4-16-12(17)10(8)6-15/h1-5H,(H,16,17) |
| InChIKey | ZJGJBHSDDDIZAP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |