C18H24N2 — CID 82092631
4-(1-cyclopentyl-5-methylpyrrol-2-yl)-N,N-dimethylaniline (PubChem CID 82092631) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-(1-cyclopentyl-5-methylpyrrol-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(1-cyclopentyl-5-methylpyrrol-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 82092631 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-(1-cyclopentyl-5-methylpyrrol-2-yl)-N,N-dimethylaniline |
| SMILES | Cc1ccc(-c2ccc(N(C)C)cc2)n1C1CCCC1 |
| InChI | InChI=1S/C18H24N2/c1-14-8-13-18(20(14)17-6-4-5-7-17)15-9-11-16(12-10-15)19(2)3/h8-13,17H,4-7H2,1-3H3 |
| InChIKey | YECAIMBPQCCVOI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|