C14H23N3O4 — CID 82098553
butyl 2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)propanoate (PubChem CID 82098553) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is butyl 2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)propanoate.
| Compound Name | butyl 2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)propanoate |
|---|---|
| PubChem CID | 82098553 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | butyl 2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)propanoate |
| SMILES | CCCCOC(=O)C(C)N1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C14H23N3O4/c1-3-4-9-21-11(18)10(2)17-7-5-14(6-8-17)12(19)15-13(20)16-14/h10H,3-9H2,1-2H3,(H2,15,16,19,20) |
| InChIKey | JOUHBHLMHWEASW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|