C10H6FN3OS — CID 82106027
4-(5-fluoro-1,3-benzoxazol-7-yl)-1,3-thiazol-2-amine (PubChem CID 82106027) has the molecular formula C10H6FN3OS and a molecular weight of 235.24 g/mol. Its IUPAC name is 4-(5-fluoro-1,3-benzoxazol-7-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(5-fluoro-1,3-benzoxazol-7-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82106027 |
| Molecular Formula | C10H6FN3OS |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 4-(5-fluoro-1,3-benzoxazol-7-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cc(F)cc3ncoc23)cs1 |
| InChI | InChI=1S/C10H6FN3OS/c11-5-1-6(8-3-16-10(12)14-8)9-7(2-5)13-4-15-9/h1-4H,(H2,12,14) |
| InChIKey | DBELUXAFTACASX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |