C8H16BrNO4 — CID 82110016
2-bromo-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-methylpropanamide (PubChem CID 82110016) has the molecular formula C8H16BrNO4 and a molecular weight of 270.12 g/mol. Its IUPAC name is 2-bromo-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-methylpropanamide.
| Compound Name | 2-bromo-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 82110016 |
| Molecular Formula | C8H16BrNO4 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-bromo-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-methylpropanamide |
| SMILES | CC(C)(Br)C(=O)NC(CO)(CO)CO |
| InChI | InChI=1S/C8H16BrNO4/c1-7(2,9)6(14)10-8(3-11,4-12)5-13/h11-13H,3-5H2,1-2H3,(H,10,14) |
| InChIKey | XBRBCFXZJJMZAX-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|