C8H11ClN2OS — CID 82110386
3-chloro-N-[1-(1,3-thiazol-5-yl)ethyl]propanamide (PubChem CID 82110386) has the molecular formula C8H11ClN2OS and a molecular weight of 218.71 g/mol. Its IUPAC name is 3-chloro-N-[1-(1,3-thiazol-5-yl)ethyl]propanamide.
| Compound Name | 3-chloro-N-[1-(1,3-thiazol-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 82110386 |
| Molecular Formula | C8H11ClN2OS |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 3-chloro-N-[1-(1,3-thiazol-5-yl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCCl)c1cncs1 |
| InChI | InChI=1S/C8H11ClN2OS/c1-6(7-4-10-5-13-7)11-8(12)2-3-9/h4-6H,2-3H2,1H3,(H,11,12) |
| InChIKey | ZAEDMLPQEAPLAN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|