C8H10O2S — CID 82111316
2-thiophen-2-yl-1,3-dioxane (PubChem CID 82111316) has the molecular formula C8H10O2S and a molecular weight of 170.23 g/mol. Its IUPAC name is 2-thiophen-2-yl-1,3-dioxane.
| Compound Name | 2-thiophen-2-yl-1,3-dioxane |
|---|---|
| PubChem CID | 82111316 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 2-thiophen-2-yl-1,3-dioxane |
| SMILES | c1csc(C2OCCCO2)c1 |
| InChI | InChI=1S/C8H10O2S/c1-3-7(11-6-1)8-9-4-2-5-10-8/h1,3,6,8H,2,4-5H2 |
| InChIKey | XXOLZDVUNIVULR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |