C10H12F2O3S — CID 134996287
2-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]thiophene (PubChem CID 134996287) has the molecular formula C10H12F2O3S and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]thiophene.
| Compound Name | 2-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]thiophene |
|---|---|
| PubChem CID | 134996287 |
| Molecular Formula | C10H12F2O3S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]thiophene |
| SMILES | COCCOCOC(=C(F)F)c1cccs1 |
| InChI | InChI=1S/C10H12F2O3S/c1-13-4-5-14-7-15-9(10(11)12)8-3-2-6-16-8/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | ISSZAPPSTKUHML-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|